C32H34N4O5 — CID 170708179
(3S)-3-[6-[(3S)-1-[[2-(oxan-4-yl)quinolin-6-yl]methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170708179) has the molecular formula C32H34N4O5 and a molecular weight of 554.65 g/mol. Its IUPAC name is (3S)-3-[6-[(3S)-1-[[2-(oxan-4-yl)quinolin-6-yl]methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3S)-3-[6-[(3S)-1-[[2-(oxan-4-yl)quinolin-6-yl]methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170708179 |
| Molecular Formula | C32H34N4O5 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | (3S)-3-[6-[(3S)-1-[[2-(oxan-4-yl)quinolin-6-yl]methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@H](N2Cc3cc(O[C@H]4CCN(Cc5ccc6nc(C7CCOCC7)ccc6c5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H34N4O5/c37-30-8-7-29(31(38)34-30)36-18-23-16-24(3-4-26(23)32(36)39)41-25-9-12-35(19-25)17-20-1-5-28-22(15-20)2-6-27(33-28)21-10-13-40-14-11-21/h1-6,15-16,21,25,29H,7-14,17-19H2,(H,34,37,38)/t25-,29-/m0/s1 |
| InChIKey | FHZIGKMHOAWTLH-SVEHJYQDSA-N |
| XLogP | 3.54 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|