C33H35N5O5 — CID 170707752
3-[6-[(3S)-1-[[2-[(3aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]quinolin-6-yl]methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170707752) has the molecular formula C33H35N5O5 and a molecular weight of 581.67 g/mol. Its IUPAC name is 3-[6-[(3S)-1-[[2-[(3aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]quinolin-6-yl]methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[(3S)-1-[[2-[(3aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]quinolin-6-yl]methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170707752 |
| Molecular Formula | C33H35N5O5 |
| Molecular Weight | 581.67 g/mol |
| Exact Mass | 581.26 |
| IUPAC Name | 3-[6-[(3S)-1-[[2-[(3aS)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrol-5-yl]quinolin-6-yl]methyl]pyrrolidin-3-yl]oxy-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(O[C@H]4CCN(Cc5ccc6nc(N7CC8COC[C@@H]8C7)ccc6c5)C4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C33H35N5O5/c39-31-8-6-29(32(40)35-31)38-16-22-12-25(3-4-27(22)33(38)41)43-26-9-10-36(17-26)13-20-1-5-28-21(11-20)2-7-30(34-28)37-14-23-18-42-19-24(23)15-37/h1-5,7,11-12,23-24,26,29H,6,8-10,13-19H2,(H,35,39,40)/t23-,24?,26-,29?/m0/s1 |
| InChIKey | VDQBYMPVZHSRDR-VKITVIMWSA-N |
| XLogP | 2.73 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.67 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|