C37H51N7O7 — CID 166715210
(4-formamidophenyl)methyl N-[1-[2-[[(2,6-dioxopiperidin-3-yl)-formylamino]methyl]-3-methylphenyl]-3-[3-[2-[4-(methylamino)piperidin-1-yl]ethoxy]propyl]azetidin-3-yl]carbamate (PubChem CID 166715210) has the molecular formula C37H51N7O7 and a molecular weight of 705.86 g/mol. Its IUPAC name is (4-formamidophenyl)methyl N-[1-[2-[[(2,6-dioxopiperidin-3-yl)-formylamino]methyl]-3-methylphenyl]-3-[3-[2-[4-(methylamino)piperidin-1-yl]ethoxy]propyl]azetidin-3-yl]carbamate.
| Compound Name | (4-formamidophenyl)methyl N-[1-[2-[[(2,6-dioxopiperidin-3-yl)-formylamino]methyl]-3-methylphenyl]-3-[3-[2-[4-(methylamino)piperidin-1-yl]ethoxy]propyl]azetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 166715210 |
| Molecular Formula | C37H51N7O7 |
| Molecular Weight | 705.86 g/mol |
| Exact Mass | 705.38 |
| IUPAC Name | (4-formamidophenyl)methyl N-[1-[2-[[(2,6-dioxopiperidin-3-yl)-formylamino]methyl]-3-methylphenyl]-3-[3-[2-[4-(methylamino)piperidin-1-yl]ethoxy]propyl]azetidin-3-yl]carbamate |
| SMILES | CNC1CCN(CCOCCCC2(NC(=O)OCc3ccc(NC=O)cc3)CN(c3cccc(C)c3CN(C=O)C3CCC(=O)NC3=O)C2)CC1 |
| InChI | InChI=1S/C37H51N7O7/c1-27-5-3-6-32(31(27)21-43(26-46)33-11-12-34(47)40-35(33)48)44-23-37(24-44,15-4-19-50-20-18-42-16-13-29(38-2)14-17-42)41-36(49)51-22-28-7-9-30(10-8-28)39-25-45/h3,5-10,25-26,29,33,38H,4,11-24H2,1-2H3,(H,39,45)(H,41,49)(H,40,47,48) |
| InChIKey | UMKMHKPDGPNEPZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 161.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.86 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|