C24H27N3O6 — CID 177223376
[4-[[(2,6-dioxopiperidin-3-yl)-formylamino]methyl]-3-methylphenyl]methyl N-[(2-methoxyphenyl)methyl]carbamate (PubChem CID 177223376) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is [4-[[(2,6-dioxopiperidin-3-yl)-formylamino]methyl]-3-methylphenyl]methyl N-[(2-methoxyphenyl)methyl]carbamate.
| Compound Name | [4-[[(2,6-dioxopiperidin-3-yl)-formylamino]methyl]-3-methylphenyl]methyl N-[(2-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 177223376 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | [4-[[(2,6-dioxopiperidin-3-yl)-formylamino]methyl]-3-methylphenyl]methyl N-[(2-methoxyphenyl)methyl]carbamate |
| SMILES | COc1ccccc1CNC(=O)OCc1ccc(CN(C=O)C2CCC(=O)NC2=O)c(C)c1 |
| InChI | InChI=1S/C24H27N3O6/c1-16-11-17(14-33-24(31)25-12-18-5-3-4-6-21(18)32-2)7-8-19(16)13-27(15-28)20-9-10-22(29)26-23(20)30/h3-8,11,15,20H,9-10,12-14H2,1-2H3,(H,25,31)(H,26,29,30) |
| InChIKey | IEARRXVDTGTNNZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|