C32H32N4O7 — CID 167275625
3-N-(2,6-dioxopiperidin-3-yl)-4-formyl-1-N-[[4-[[[2-(2-methoxyphenyl)acetyl]amino]methyl]phenyl]methyl]-3-N-methylbenzene-1,3-dicarboxamide (PubChem CID 167275625) has the molecular formula C32H32N4O7 and a molecular weight of 584.63 g/mol. Its IUPAC name is 3-N-(2,6-dioxopiperidin-3-yl)-4-formyl-1-N-[[4-[[[2-(2-methoxyphenyl)acetyl]amino]methyl]phenyl]methyl]-3-N-methylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-(2,6-dioxopiperidin-3-yl)-4-formyl-1-N-[[4-[[[2-(2-methoxyphenyl)acetyl]amino]methyl]phenyl]methyl]-3-N-methylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 167275625 |
| Molecular Formula | C32H32N4O7 |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | 3-N-(2,6-dioxopiperidin-3-yl)-4-formyl-1-N-[[4-[[[2-(2-methoxyphenyl)acetyl]amino]methyl]phenyl]methyl]-3-N-methylbenzene-1,3-dicarboxamide |
| SMILES | COc1ccccc1CC(=O)NCc1ccc(CNC(=O)c2ccc(C=O)c(C(=O)N(C)C3CCC(=O)NC3=O)c2)cc1 |
| InChI | InChI=1S/C32H32N4O7/c1-36(26-13-14-28(38)35-31(26)41)32(42)25-15-23(11-12-24(25)19-37)30(40)34-18-21-9-7-20(8-10-21)17-33-29(39)16-22-5-3-4-6-27(22)43-2/h3-12,15,19,26H,13-14,16-18H2,1-2H3,(H,33,39)(H,34,40)(H,35,38,41) |
| InChIKey | NDMAWWBXLFNLMU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|