C24H41N7O4 — CID 156882699
2-[2-[2-[amino-[(Z)-2-amino-3-formamidoprop-1-enyl]amino]ethylamino]ethoxy]-N-[3-formyl-2-[[methyl(pentan-2-yl)amino]methyl]phenyl]acetamide (PubChem CID 156882699) has the molecular formula C24H41N7O4 and a molecular weight of 491.64 g/mol. Its IUPAC name is 2-[2-[2-[amino-[(Z)-2-amino-3-formamidoprop-1-enyl]amino]ethylamino]ethoxy]-N-[3-formyl-2-[[methyl(pentan-2-yl)amino]methyl]phenyl]acetamide.
| Compound Name | 2-[2-[2-[amino-[(Z)-2-amino-3-formamidoprop-1-enyl]amino]ethylamino]ethoxy]-N-[3-formyl-2-[[methyl(pentan-2-yl)amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 156882699 |
| Molecular Formula | C24H41N7O4 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.32 |
| IUPAC Name | 2-[2-[2-[amino-[(Z)-2-amino-3-formamidoprop-1-enyl]amino]ethylamino]ethoxy]-N-[3-formyl-2-[[methyl(pentan-2-yl)amino]methyl]phenyl]acetamide |
| SMILES | CCCC(C)N(C)Cc1c(C=O)cccc1NC(=O)COCCNCCN(N)/C=C(\N)CNC=O |
| InChI | InChI=1S/C24H41N7O4/c1-4-6-19(2)30(3)15-22-20(16-32)7-5-8-23(22)29-24(34)17-35-12-10-27-9-11-31(26)14-21(25)13-28-18-33/h5,7-8,14,16,18-19,27H,4,6,9-13,15,17,25-26H2,1-3H3,(H,28,33)(H,29,34)/b21-14- |
| InChIKey | YPFRMJZFIULKPU-STZFKDTASA-N |
| XLogP | 0.39 |
| TPSA | 155.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|