C30H44N8O5 — CID 166715065
4-amino-N-[(Z)-2-amino-3-[amino-[2-[2-[2-[3-formyl-2-[[methyl(1-oxopentan-2-yl)amino]methyl]anilino]-2-oxoethoxy]ethylamino]ethyl]amino]prop-2-enyl]benzamide (PubChem CID 166715065) has the molecular formula C30H44N8O5 and a molecular weight of 596.73 g/mol. Its IUPAC name is 4-amino-N-[(Z)-2-amino-3-[amino-[2-[2-[2-[3-formyl-2-[[methyl(1-oxopentan-2-yl)amino]methyl]anilino]-2-oxoethoxy]ethylamino]ethyl]amino]prop-2-enyl]benzamide.
| Compound Name | 4-amino-N-[(Z)-2-amino-3-[amino-[2-[2-[2-[3-formyl-2-[[methyl(1-oxopentan-2-yl)amino]methyl]anilino]-2-oxoethoxy]ethylamino]ethyl]amino]prop-2-enyl]benzamide |
|---|---|
| PubChem CID | 166715065 |
| Molecular Formula | C30H44N8O5 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.34 |
| IUPAC Name | 4-amino-N-[(Z)-2-amino-3-[amino-[2-[2-[2-[3-formyl-2-[[methyl(1-oxopentan-2-yl)amino]methyl]anilino]-2-oxoethoxy]ethylamino]ethyl]amino]prop-2-enyl]benzamide |
| SMILES | CCCC(C=O)N(C)Cc1c(C=O)cccc1NC(=O)COCCNCCN(N)/C=C(\N)CNC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C30H44N8O5/c1-3-5-26(20-40)37(2)18-27-23(19-39)6-4-7-28(27)36-29(41)21-43-15-13-34-12-14-38(33)17-25(32)16-35-30(42)22-8-10-24(31)11-9-22/h4,6-11,17,19-20,26,34H,3,5,12-16,18,21,31-33H2,1-2H3,(H,35,42)(H,36,41)/b25-17- |
| InChIKey | VVVHLZQDQYJDPD-UQQQWYQISA-N |
| XLogP | 0.83 |
| TPSA | 198.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|