C22H36N4O3 — CID 166714865
2-[2-[2-(ethenylamino)ethoxy]ethylamino]-N-[3-formyl-2-[[methyl(pentan-2-yl)amino]methyl]phenyl]acetamide (PubChem CID 166714865) has the molecular formula C22H36N4O3 and a molecular weight of 404.56 g/mol. Its IUPAC name is 2-[2-[2-(ethenylamino)ethoxy]ethylamino]-N-[3-formyl-2-[[methyl(pentan-2-yl)amino]methyl]phenyl]acetamide.
| Compound Name | 2-[2-[2-(ethenylamino)ethoxy]ethylamino]-N-[3-formyl-2-[[methyl(pentan-2-yl)amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 166714865 |
| Molecular Formula | C22H36N4O3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 2-[2-[2-(ethenylamino)ethoxy]ethylamino]-N-[3-formyl-2-[[methyl(pentan-2-yl)amino]methyl]phenyl]acetamide |
| SMILES | C=CNCCOCCNCC(=O)Nc1cccc(C=O)c1CN(C)C(C)CCC |
| InChI | InChI=1S/C22H36N4O3/c1-5-8-18(3)26(4)16-20-19(17-27)9-7-10-21(20)25-22(28)15-24-12-14-29-13-11-23-6-2/h6-7,9-10,17-18,23-24H,2,5,8,11-16H2,1,3-4H3,(H,25,28) |
| InChIKey | CEJSZQSZOPGWGL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|