C35H54N6O9 — CID 156882644
4-amino-3-methoxybenzaldehyde;N-formylformamide;3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethylamino]-N-(1-oxo-2-pentan-2-yl-3H-isoindol-4-yl)propanamide (PubChem CID 156882644) has the molecular formula C35H54N6O9 and a molecular weight of 702.85 g/mol. Its IUPAC name is 4-amino-3-methoxybenzaldehyde;N-formylformamide;3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethylamino]-N-(1-oxo-2-pentan-2-yl-3H-isoindol-4-yl)propanamide.
| Compound Name | 4-amino-3-methoxybenzaldehyde;N-formylformamide;3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethylamino]-N-(1-oxo-2-pentan-2-yl-3H-isoindol-4-yl)propanamide |
|---|---|
| PubChem CID | 156882644 |
| Molecular Formula | C35H54N6O9 |
| Molecular Weight | 702.85 g/mol |
| Exact Mass | 702.40 |
| IUPAC Name | 4-amino-3-methoxybenzaldehyde;N-formylformamide;3-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethylamino]-N-(1-oxo-2-pentan-2-yl-3H-isoindol-4-yl)propanamide |
| SMILES | CCCC(C)N1Cc2c(NC(=O)CCNCCOCCOCCOCCNC)cccc2C1=O.COc1cc(C=O)ccc1N.O=CNC=O |
| InChI | InChI=1S/C25H42N4O5.C8H9NO2.C2H3NO2/c1-4-6-20(2)29-19-22-21(25(29)31)7-5-8-23(22)28-24(30)9-10-27-12-14-33-16-18-34-17-15-32-13-11-26-3;1-11-8-4-6(5-10)2-3-7(8)9;4-1-3-2-5/h5,7-8,20,26-27H,4,6,9-19H2,1-3H3,(H,28,30);2-5H,9H2,1H3;1-2H,(H,3,4,5) |
| InChIKey | MKIDEGOTGMYACX-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 199.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.85 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|