C22H33N3O5 — CID 170590672
4-(7-amino-3-oxo-1H-isoindol-2-yl)-N-formylpentanamide;2,2,4-trimethylpentanoic acid (PubChem CID 170590672) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is 4-(7-amino-3-oxo-1H-isoindol-2-yl)-N-formylpentanamide;2,2,4-trimethylpentanoic acid.
| Compound Name | 4-(7-amino-3-oxo-1H-isoindol-2-yl)-N-formylpentanamide;2,2,4-trimethylpentanoic acid |
|---|---|
| PubChem CID | 170590672 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 4-(7-amino-3-oxo-1H-isoindol-2-yl)-N-formylpentanamide;2,2,4-trimethylpentanoic acid |
| SMILES | CC(C)CC(C)(C)C(=O)O.CC(CCC(=O)NC=O)N1Cc2c(N)cccc2C1=O |
| InChI | InChI=1S/C14H17N3O3.C8H16O2/c1-9(5-6-13(19)16-8-18)17-7-11-10(14(17)20)3-2-4-12(11)15;1-6(2)5-8(3,4)7(9)10/h2-4,8-9H,5-7,15H2,1H3,(H,16,18,19);6H,5H2,1-4H3,(H,9,10) |
| InChIKey | UHDQUVYBRGVXRA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|