C13H17N3O4 — CID 137445596
4-(7-amino-3-oxo-1H-isoindol-2-yl)-5,5-dihydroxypentanamide (PubChem CID 137445596) has the molecular formula C13H17N3O4 and a molecular weight of 279.30 g/mol. Its IUPAC name is 4-(7-amino-3-oxo-1H-isoindol-2-yl)-5,5-dihydroxypentanamide.
| Compound Name | 4-(7-amino-3-oxo-1H-isoindol-2-yl)-5,5-dihydroxypentanamide |
|---|---|
| PubChem CID | 137445596 |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 4-(7-amino-3-oxo-1H-isoindol-2-yl)-5,5-dihydroxypentanamide |
| SMILES | NC(=O)CCC(C(O)O)N1Cc2c(N)cccc2C1=O |
| InChI | InChI=1S/C13H17N3O4/c14-9-3-1-2-7-8(9)6-16(12(7)18)10(13(19)20)4-5-11(15)17/h1-3,10,13,19-20H,4-6,14H2,(H2,15,17) |
| InChIKey | INXBAESRYWBKEO-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 129.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|