C31H44N6O7 — CID 156883005
3-[2-[2-[2-[[(Z)-2-amino-2-(4-aminophenyl)ethenyl]amino]ethoxy]ethoxy]ethoxy]propanamide;N-formyl-4-(3-oxo-1H-isoindol-2-yl)pentanamide (PubChem CID 156883005) has the molecular formula C31H44N6O7 and a molecular weight of 612.73 g/mol. Its IUPAC name is 3-[2-[2-[2-[[(Z)-2-amino-2-(4-aminophenyl)ethenyl]amino]ethoxy]ethoxy]ethoxy]propanamide;N-formyl-4-(3-oxo-1H-isoindol-2-yl)pentanamide.
| Compound Name | 3-[2-[2-[2-[[(Z)-2-amino-2-(4-aminophenyl)ethenyl]amino]ethoxy]ethoxy]ethoxy]propanamide;N-formyl-4-(3-oxo-1H-isoindol-2-yl)pentanamide |
|---|---|
| PubChem CID | 156883005 |
| Molecular Formula | C31H44N6O7 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.33 |
| IUPAC Name | 3-[2-[2-[2-[[(Z)-2-amino-2-(4-aminophenyl)ethenyl]amino]ethoxy]ethoxy]ethoxy]propanamide;N-formyl-4-(3-oxo-1H-isoindol-2-yl)pentanamide |
| SMILES | CC(CCC(=O)NC=O)N1Cc2ccccc2C1=O.NC(=O)CCOCCOCCOCCN/C=C(\N)c1ccc(N)cc1 |
| InChI | InChI=1S/C17H28N4O4.C14H16N2O3/c18-15-3-1-14(2-4-15)16(19)13-21-6-8-24-10-12-25-11-9-23-7-5-17(20)22;1-10(6-7-13(18)15-9-17)16-8-11-4-2-3-5-12(11)14(16)19/h1-4,13,21H,5-12,18-19H2,(H2,20,22);2-5,9-10H,6-8H2,1H3,(H,15,17,18)/b16-13-; |
| InChIKey | ZJNSRTDPTUUCED-UNVLYCKESA-N |
| XLogP | 1.12 |
| TPSA | 201.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|