C34H47N5O4 — CID 162439156
4-[5-[[2-(5-formamido-5-oxopentan-2-yl)-3-oxo-1H-isoindol-5-yl]amino]pentylamino]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide (PubChem CID 162439156) has the molecular formula C34H47N5O4 and a molecular weight of 589.78 g/mol. Its IUPAC name is 4-[5-[[2-(5-formamido-5-oxopentan-2-yl)-3-oxo-1H-isoindol-5-yl]amino]pentylamino]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide.
| Compound Name | 4-[5-[[2-(5-formamido-5-oxopentan-2-yl)-3-oxo-1H-isoindol-5-yl]amino]pentylamino]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide |
|---|---|
| PubChem CID | 162439156 |
| Molecular Formula | C34H47N5O4 |
| Molecular Weight | 589.78 g/mol |
| Exact Mass | 589.36 |
| IUPAC Name | 4-[5-[[2-(5-formamido-5-oxopentan-2-yl)-3-oxo-1H-isoindol-5-yl]amino]pentylamino]-N-(2,2,4,4-tetramethylcyclobutyl)benzamide |
| SMILES | CC(CCC(=O)NC=O)N1Cc2ccc(NCCCCCNc3ccc(C(=O)NC4C(C)(C)CC4(C)C)cc3)cc2C1=O |
| InChI | InChI=1S/C34H47N5O4/c1-23(9-16-29(41)37-22-40)39-20-25-12-15-27(19-28(25)31(39)43)36-18-8-6-7-17-35-26-13-10-24(11-14-26)30(42)38-32-33(2,3)21-34(32,4)5/h10-15,19,22-23,32,35-36H,6-9,16-18,20-21H2,1-5H3,(H,38,42)(H,37,40,41) |
| InChIKey | QGAMAYWWILEZNU-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 119.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.78 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|