C25H30N2O4 — CID 76703673
2-[5-(octanoylamino)-3-oxo-1H-isoindol-2-yl]-3-phenylpropanoic acid (PubChem CID 76703673) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-[5-(octanoylamino)-3-oxo-1H-isoindol-2-yl]-3-phenylpropanoic acid.
| Compound Name | 2-[5-(octanoylamino)-3-oxo-1H-isoindol-2-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 76703673 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-[5-(octanoylamino)-3-oxo-1H-isoindol-2-yl]-3-phenylpropanoic acid |
| SMILES | CCCCCCCC(=O)Nc1ccc2c(c1)C(=O)N(C(Cc1ccccc1)C(=O)O)C2 |
| InChI | InChI=1S/C25H30N2O4/c1-2-3-4-5-9-12-23(28)26-20-14-13-19-17-27(24(29)21(19)16-20)22(25(30)31)15-18-10-7-6-8-11-18/h6-8,10-11,13-14,16,22H,2-5,9,12,15,17H2,1H3,(H,26,28)(H,30,31) |
| InChIKey | PSOZZSVMYVESSA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|