C25H28N2O5 — CID 76703678
2-[5-(octanoylamino)-1,3-dioxoisoindol-2-yl]-3-phenylpropanoic acid (PubChem CID 76703678) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 2-[5-(octanoylamino)-1,3-dioxoisoindol-2-yl]-3-phenylpropanoic acid.
| Compound Name | 2-[5-(octanoylamino)-1,3-dioxoisoindol-2-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 76703678 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 2-[5-(octanoylamino)-1,3-dioxoisoindol-2-yl]-3-phenylpropanoic acid |
| SMILES | CCCCCCCC(=O)Nc1ccc2c(c1)C(=O)N(C(Cc1ccccc1)C(=O)O)C2=O |
| InChI | InChI=1S/C25H28N2O5/c1-2-3-4-5-9-12-22(28)26-18-13-14-19-20(16-18)24(30)27(23(19)29)21(25(31)32)15-17-10-7-6-8-11-17/h6-8,10-11,13-14,16,21H,2-5,9,12,15H2,1H3,(H,26,28)(H,31,32) |
| InChIKey | YHGDRPDMSXLJIV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|