C27H40BN3O3 — CID 169190740
CID 169190740 (PubChem CID 169190740) has the molecular formula C27H40BN3O3 and a molecular weight of 465.45 g/mol.
| Compound Name | CID 169190740 |
|---|---|
| PubChem CID | 169190740 |
| Molecular Formula | C27H40BN3O3 |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.32 |
| IUPAC Name | — |
| SMILES | Cc1ccc2c(c1)CN(C(C)CCC(=O)NC=O)C2=O.[B]C1(NC2CCCCC2)CC(C)(C)C1 |
| InChI | InChI=1S/C15H18N2O3.C12H22BN/c1-10-3-5-13-12(7-10)8-17(15(13)20)11(2)4-6-14(19)16-9-18;1-11(2)8-12(13,9-11)14-10-6-4-3-5-7-10/h3,5,7,9,11H,4,6,8H2,1-2H3,(H,16,18,19);10,14H,3-9H2,1-2H3 |
| InChIKey | LQVZJPPNRRRUCB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|