C27H41N3O3S — CID 166921166
2-[6-[7-(cyclohexylamino)heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide (PubChem CID 166921166) has the molecular formula C27H41N3O3S and a molecular weight of 487.71 g/mol. Its IUPAC name is 2-[6-[7-(cyclohexylamino)heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide.
| Compound Name | 2-[6-[7-(cyclohexylamino)heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide |
|---|---|
| PubChem CID | 166921166 |
| Molecular Formula | C27H41N3O3S |
| Molecular Weight | 487.71 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 2-[6-[7-(cyclohexylamino)heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide |
| SMILES | CCCC(C(=O)NC=O)N1Cc2cc(SCCCCCCCNC3CCCCC3)ccc2C1=O |
| InChI | InChI=1S/C27H41N3O3S/c1-2-11-25(26(32)29-20-31)30-19-21-18-23(14-15-24(21)27(30)33)34-17-10-5-3-4-9-16-28-22-12-7-6-8-13-22/h14-15,18,20,22,25,28H,2-13,16-17,19H2,1H3,(H,29,31,32) |
| InChIKey | AELLPIONHQMTLD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.71 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|