C25H26N4O3 — CID 174283198
2-[6-(1,4-dimethyl-5-phenylpyrazol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide (PubChem CID 174283198) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 2-[6-(1,4-dimethyl-5-phenylpyrazol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide.
| Compound Name | 2-[6-(1,4-dimethyl-5-phenylpyrazol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide |
|---|---|
| PubChem CID | 174283198 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 2-[6-(1,4-dimethyl-5-phenylpyrazol-3-yl)-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide |
| SMILES | CCCC(C(=O)NC=O)N1Cc2cc(-c3nn(C)c(-c4ccccc4)c3C)ccc2C1=O |
| InChI | InChI=1S/C25H26N4O3/c1-4-8-21(24(31)26-15-30)29-14-19-13-18(11-12-20(19)25(29)32)22-16(2)23(28(3)27-22)17-9-6-5-7-10-17/h5-7,9-13,15,21H,4,8,14H2,1-3H3,(H,26,30,31) |
| InChIKey | ZYOXVMAWVLJLJL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|