C25H22F2N4O5 — CID 174285976
2-[6-[5-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazol-4-yl]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide (PubChem CID 174285976) has the molecular formula C25H22F2N4O5 and a molecular weight of 496.47 g/mol. Its IUPAC name is 2-[6-[5-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazol-4-yl]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide.
| Compound Name | 2-[6-[5-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazol-4-yl]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide |
|---|---|
| PubChem CID | 174285976 |
| Molecular Formula | C25H22F2N4O5 |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 2-[6-[5-(2,2-difluoro-1,3-benzodioxol-5-yl)-1-methylpyrazol-4-yl]-3-oxo-1H-isoindol-2-yl]-N-formylpentanamide |
| SMILES | CCCC(C(=O)NC=O)N1Cc2cc(-c3cnn(C)c3-c3ccc4c(c3)OC(F)(F)O4)ccc2C1=O |
| InChI | InChI=1S/C25H22F2N4O5/c1-3-4-19(23(33)28-13-32)31-12-16-9-14(5-7-17(16)24(31)34)18-11-29-30(2)22(18)15-6-8-20-21(10-15)36-25(26,27)35-20/h5-11,13,19H,3-4,12H2,1-2H3,(H,28,32,33) |
| InChIKey | GYGIZBOPABACBF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|