C21H17ClFN3O2 — CID 86681462
(2S)-2-[6-(4-chloro-1-methylpyrazol-5-yl)-3-oxo-1H-isoindol-2-yl]-3-(3-fluorophenyl)propanal (PubChem CID 86681462) has the molecular formula C21H17ClFN3O2 and a molecular weight of 397.84 g/mol. Its IUPAC name is (2S)-2-[6-(4-chloro-1-methylpyrazol-5-yl)-3-oxo-1H-isoindol-2-yl]-3-(3-fluorophenyl)propanal.
| Compound Name | (2S)-2-[6-(4-chloro-1-methylpyrazol-5-yl)-3-oxo-1H-isoindol-2-yl]-3-(3-fluorophenyl)propanal |
|---|---|
| PubChem CID | 86681462 |
| Molecular Formula | C21H17ClFN3O2 |
| Molecular Weight | 397.84 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | (2S)-2-[6-(4-chloro-1-methylpyrazol-5-yl)-3-oxo-1H-isoindol-2-yl]-3-(3-fluorophenyl)propanal |
| SMILES | Cn1ncc(Cl)c1-c1ccc2c(c1)CN([C@H](C=O)Cc1cccc(F)c1)C2=O |
| InChI | InChI=1S/C21H17ClFN3O2/c1-25-20(19(22)10-24-25)14-5-6-18-15(9-14)11-26(21(18)28)17(12-27)8-13-3-2-4-16(23)7-13/h2-7,9-10,12,17H,8,11H2,1H3/t17-/m0/s1 |
| InChIKey | RMQGQOUOOCATSE-KRWDZBQOSA-N |
| XLogP | 3.65 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.84 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|