C29H21F2IN4O3 — CID 89499760
2-[(2S)-3-(3,5-difluorophenyl)-2-[6-(4-iodo-1-methylpyrazol-5-yl)-3-oxo-1H-isoindol-2-yl]propyl]isoindole-1,3-dione (PubChem CID 89499760) has the molecular formula C29H21F2IN4O3 and a molecular weight of 638.41 g/mol. Its IUPAC name is 2-[(2S)-3-(3,5-difluorophenyl)-2-[6-(4-iodo-1-methylpyrazol-5-yl)-3-oxo-1H-isoindol-2-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[(2S)-3-(3,5-difluorophenyl)-2-[6-(4-iodo-1-methylpyrazol-5-yl)-3-oxo-1H-isoindol-2-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 89499760 |
| Molecular Formula | C29H21F2IN4O3 |
| Molecular Weight | 638.41 g/mol |
| Exact Mass | 638.06 |
| IUPAC Name | 2-[(2S)-3-(3,5-difluorophenyl)-2-[6-(4-iodo-1-methylpyrazol-5-yl)-3-oxo-1H-isoindol-2-yl]propyl]isoindole-1,3-dione |
| SMILES | Cn1ncc(I)c1-c1ccc2c(c1)CN([C@@H](Cc1cc(F)cc(F)c1)CN1C(=O)c3ccccc3C1=O)C2=O |
| InChI | InChI=1S/C29H21F2IN4O3/c1-34-26(25(32)13-33-34)17-6-7-22-18(11-17)14-35(27(22)37)21(10-16-8-19(30)12-20(31)9-16)15-36-28(38)23-4-2-3-5-24(23)29(36)39/h2-9,11-13,21H,10,14-15H2,1H3/t21-/m0/s1 |
| InChIKey | SHQPARFJKSYGOH-NRFANRHFSA-N |
| XLogP | 4.83 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|