C29H22F2N4O3 — CID 123465113
2-[2-[6-(4-fluoro-1-methylpyrazol-5-yl)-3-oxo-1H-isoindol-2-yl]-3-(3-fluorophenyl)propyl]isoindole-1,3-dione (PubChem CID 123465113) has the molecular formula C29H22F2N4O3 and a molecular weight of 512.52 g/mol. Its IUPAC name is 2-[2-[6-(4-fluoro-1-methylpyrazol-5-yl)-3-oxo-1H-isoindol-2-yl]-3-(3-fluorophenyl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[6-(4-fluoro-1-methylpyrazol-5-yl)-3-oxo-1H-isoindol-2-yl]-3-(3-fluorophenyl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 123465113 |
| Molecular Formula | C29H22F2N4O3 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 2-[2-[6-(4-fluoro-1-methylpyrazol-5-yl)-3-oxo-1H-isoindol-2-yl]-3-(3-fluorophenyl)propyl]isoindole-1,3-dione |
| SMILES | Cn1ncc(F)c1-c1ccc2c(c1)CN(C(Cc1cccc(F)c1)CN1C(=O)c3ccccc3C1=O)C2=O |
| InChI | InChI=1S/C29H22F2N4O3/c1-33-26(25(31)14-32-33)18-9-10-22-19(13-18)15-34(27(22)36)21(12-17-5-4-6-20(30)11-17)16-35-28(37)23-7-2-3-8-24(23)29(35)38/h2-11,13-14,21H,12,15-16H2,1H3 |
| InChIKey | MMFIDXMKFBJDNU-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|