C37H46FN5O5 — CID 168961728
1-benzyl-3-(1-benzylpiperidin-4-yl)urea;[2-(5-formamido-5-oxopentan-2-yl)-1-oxo-3H-isoindol-5-yl] hypofluorite;prop-1-ene (PubChem CID 168961728) has the molecular formula C37H46FN5O5 and a molecular weight of 659.80 g/mol. Its IUPAC name is 1-benzyl-3-(1-benzylpiperidin-4-yl)urea;[2-(5-formamido-5-oxopentan-2-yl)-1-oxo-3H-isoindol-5-yl] hypofluorite;prop-1-ene.
| Compound Name | 1-benzyl-3-(1-benzylpiperidin-4-yl)urea;[2-(5-formamido-5-oxopentan-2-yl)-1-oxo-3H-isoindol-5-yl] hypofluorite;prop-1-ene |
|---|---|
| PubChem CID | 168961728 |
| Molecular Formula | C37H46FN5O5 |
| Molecular Weight | 659.80 g/mol |
| Exact Mass | 659.35 |
| IUPAC Name | 1-benzyl-3-(1-benzylpiperidin-4-yl)urea;[2-(5-formamido-5-oxopentan-2-yl)-1-oxo-3H-isoindol-5-yl] hypofluorite;prop-1-ene |
| SMILES | C=CC.CC(CCC(=O)NC=O)N1Cc2cc(OF)ccc2C1=O.O=C(NCc1ccccc1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H25N3O.C14H15FN2O4.C3H6/c24-20(21-15-17-7-3-1-4-8-17)22-19-11-13-23(14-12-19)16-18-9-5-2-6-10-18;1-9(2-5-13(19)16-8-18)17-7-10-6-11(21-15)3-4-12(10)14(17)20;1-3-2/h1-10,19H,11-16H2,(H2,21,22,24);3-4,6,8-9H,2,5,7H2,1H3,(H,16,18,19);3H,1H2,2H3 |
| InChIKey | XEBRHZASSMGOKL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.80 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|