About 4-(3-oxopropoxy)phthalic acid
4-(3-oxopropoxy)phthalic acid (PubChem CID 57222594) has the molecular formula C11H10O6
and a molecular weight of 238.19 g/mol. Its IUPAC name is 4-(3-oxopropoxy)phthalic acid.
Molecular Properties
| Compound Name | 4-(3-oxopropoxy)phthalic acid |
| PubChem CID | 57222594 |
| Molecular Formula | C11H10O6 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 4-(3-oxopropoxy)phthalic acid |
| SMILES | O=CCCOc1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H10O6/c12-4-1-5-17-7-2-3-8(10(13)14)9(6-7)11(15)16/h2-4,6H,1,5H2,(H,13,14)(H,15,16) |
| InChIKey | IRHUBWCUXFBWJH-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-oxopropoxy)phthalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-oxopropoxy)phthalic acid?
The IUPAC name of 4-(3-oxopropoxy)phthalic acid (CID 57222594) is 4-(3-oxopropoxy)phthalic acid.
What is the SMILES notation for 4-(3-oxopropoxy)phthalic acid?
The canonical SMILES for 4-(3-oxopropoxy)phthalic acid is O=CCCOc1ccc(C(=O)O)c(C(=O)O)c1.
What is the InChIKey of 4-(3-oxopropoxy)phthalic acid?
The InChIKey is IRHUBWCUXFBWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O6/c12-4-1-5-17-7-2-3-8(10(13)14)9(6-7)11(15)16/h2-4,6H,1,5H2,(H,13,14)(H,15,16).
What are the key properties of 4-(3-oxopropoxy)phthalic acid?
4-(3-oxopropoxy)phthalic acid has a molecular weight of 238.19 g/mol, XLogP of 1.05, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-oxopropoxy)phthalic acid is sourced from PubChem (CID 57222594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).