4-(3-oxopropoxy)phthalic acid

C11H10O6 — CID 57222594

IUPAC4-(3-oxopropoxy)phthalic acid
SMILESO=CCCOc1ccc(C(=O)O)c(C(=O)O)c1
InChIInChI=1S/C11H10O6/c12-4-1-5-17-7-2-3-8(10(13)14)9(6-7)11(15)16/h2-4,6H,1,5H2,(H,13,14)(H,15,16)
InChIKeyIRHUBWCUXFBWJH-UHFFFAOYSA-N
MW238.19 g/mol
LogP1.05
Rot. Bonds6

About 4-(3-oxopropoxy)phthalic acid

4-(3-oxopropoxy)phthalic acid (PubChem CID 57222594) has the molecular formula C11H10O6 and a molecular weight of 238.19 g/mol. Its IUPAC name is 4-(3-oxopropoxy)phthalic acid.

Molecular Properties

Compound Name4-(3-oxopropoxy)phthalic acid
PubChem CID57222594
Molecular FormulaC11H10O6
Molecular Weight238.19 g/mol
Exact Mass238.05
IUPAC Name4-(3-oxopropoxy)phthalic acid
SMILESO=CCCOc1ccc(C(=O)O)c(C(=O)O)c1
InChIInChI=1S/C11H10O6/c12-4-1-5-17-7-2-3-8(10(13)14)9(6-7)11(15)16/h2-4,6H,1,5H2,(H,13,14)(H,15,16)
InChIKeyIRHUBWCUXFBWJH-UHFFFAOYSA-N
XLogP1.05
TPSA100.90 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.19
LogP ≤ 51.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 4-(3-oxopropoxy)phthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-oxopropoxy)phthalic acid?
The IUPAC name of 4-(3-oxopropoxy)phthalic acid (CID 57222594) is 4-(3-oxopropoxy)phthalic acid.
What is the SMILES notation for 4-(3-oxopropoxy)phthalic acid?
The canonical SMILES for 4-(3-oxopropoxy)phthalic acid is O=CCCOc1ccc(C(=O)O)c(C(=O)O)c1.
What is the InChIKey of 4-(3-oxopropoxy)phthalic acid?
The InChIKey is IRHUBWCUXFBWJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O6/c12-4-1-5-17-7-2-3-8(10(13)14)9(6-7)11(15)16/h2-4,6H,1,5H2,(H,13,14)(H,15,16).
What are the key properties of 4-(3-oxopropoxy)phthalic acid?
4-(3-oxopropoxy)phthalic acid has a molecular weight of 238.19 g/mol, XLogP of 1.05, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-oxopropoxy)phthalic acid is sourced from PubChem (CID 57222594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).