C26H40O4 — CID 175396015
4-butoxy-2,6-diethylphenol;4-butoxy-2,6-dimethylphenol (PubChem CID 175396015) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is 4-butoxy-2,6-diethylphenol;4-butoxy-2,6-dimethylphenol.
| Compound Name | 4-butoxy-2,6-diethylphenol;4-butoxy-2,6-dimethylphenol |
|---|---|
| PubChem CID | 175396015 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 4-butoxy-2,6-diethylphenol;4-butoxy-2,6-dimethylphenol |
| SMILES | CCCCOc1cc(C)c(O)c(C)c1.CCCCOc1cc(CC)c(O)c(CC)c1 |
| InChI | InChI=1S/C14H22O2.C12H18O2/c1-4-7-8-16-13-9-11(5-2)14(15)12(6-3)10-13;1-4-5-6-14-11-7-9(2)12(13)10(3)8-11/h9-10,15H,4-8H2,1-3H3;7-8,13H,4-6H2,1-3H3 |
| InChIKey | GUYQWXNMLLCPLD-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|