C30H48O4Si — CID 19088137
4-[[dibutyl-[(3,5-diethyl-4-hydroxyphenoxy)methyl]silyl]methoxy]-2,6-diethylphenol (PubChem CID 19088137) has the molecular formula C30H48O4Si and a molecular weight of 500.80 g/mol. Its IUPAC name is 4-[[dibutyl-[(3,5-diethyl-4-hydroxyphenoxy)methyl]silyl]methoxy]-2,6-diethylphenol.
| Compound Name | 4-[[dibutyl-[(3,5-diethyl-4-hydroxyphenoxy)methyl]silyl]methoxy]-2,6-diethylphenol |
|---|---|
| PubChem CID | 19088137 |
| Molecular Formula | C30H48O4Si |
| Molecular Weight | 500.80 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | 4-[[dibutyl-[(3,5-diethyl-4-hydroxyphenoxy)methyl]silyl]methoxy]-2,6-diethylphenol |
| SMILES | CCCC[Si](CCCC)(COc1cc(CC)c(O)c(CC)c1)COc1cc(CC)c(O)c(CC)c1 |
| InChI | InChI=1S/C30H48O4Si/c1-7-13-15-35(16-14-8-2,21-33-27-17-23(9-3)29(31)24(10-4)18-27)22-34-28-19-25(11-5)30(32)26(12-6)20-28/h17-20,31-32H,7-16,21-22H2,1-6H3 |
| InChIKey | KEUCWGIKIOZGTR-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.80 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|