C17H27NO5 — CID 11461522
(2S,3R,4R,5S)-1-[(4-butoxyphenyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol (PubChem CID 11461522) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2S,3R,4R,5S)-1-[(4-butoxyphenyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-1-[(4-butoxyphenyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 11461522 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (2S,3R,4R,5S)-1-[(4-butoxyphenyl)methyl]-2-(hydroxymethyl)piperidine-3,4,5-triol |
| SMILES | CCCCOc1ccc(CN2C[C@H](O)[C@@H](O)[C@H](O)[C@@H]2CO)cc1 |
| InChI | InChI=1S/C17H27NO5/c1-2-3-8-23-13-6-4-12(5-7-13)9-18-10-15(20)17(22)16(21)14(18)11-19/h4-7,14-17,19-22H,2-3,8-11H2,1H3/t14-,15-,16+,17+/m0/s1 |
| InChIKey | KRANEQWPXTUBEZ-MWDXBVQZSA-N |
| XLogP | 0.12 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|