C29H44Cl2N2O10 — CID 90664291
(3S,4R,5R,6S)-1-[[4-[3-[4-[[(3S,4R,5R,6S)-3,4,5,6-tetrahydroxyazepan-1-yl]methyl]phenoxy]propoxy]phenyl]methyl]azepane-3,4,5,6-tetrol;dihydrochloride (PubChem CID 90664291) has the molecular formula C29H44Cl2N2O10 and a molecular weight of 651.58 g/mol. Its IUPAC name is (3S,4R,5R,6S)-1-[[4-[3-[4-[[(3S,4R,5R,6S)-3,4,5,6-tetrahydroxyazepan-1-yl]methyl]phenoxy]propoxy]phenyl]methyl]azepane-3,4,5,6-tetrol;dihydrochloride.
| Compound Name | (3S,4R,5R,6S)-1-[[4-[3-[4-[[(3S,4R,5R,6S)-3,4,5,6-tetrahydroxyazepan-1-yl]methyl]phenoxy]propoxy]phenyl]methyl]azepane-3,4,5,6-tetrol;dihydrochloride |
|---|---|
| PubChem CID | 90664291 |
| Molecular Formula | C29H44Cl2N2O10 |
| Molecular Weight | 651.58 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | (3S,4R,5R,6S)-1-[[4-[3-[4-[[(3S,4R,5R,6S)-3,4,5,6-tetrahydroxyazepan-1-yl]methyl]phenoxy]propoxy]phenyl]methyl]azepane-3,4,5,6-tetrol;dihydrochloride |
| SMILES | Cl.Cl.O[C@H]1[C@H](O)[C@@H](O)CN(Cc2ccc(OCCCOc3ccc(CN4C[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)C4)cc3)cc2)C[C@@H]1O |
| InChI | InChI=1S/C29H42N2O10.2ClH/c32-22-14-30(15-23(33)27(37)26(22)36)12-18-2-6-20(7-3-18)40-10-1-11-41-21-8-4-19(5-9-21)13-31-16-24(34)28(38)29(39)25(35)17-31;;/h2-9,22-29,32-39H,1,10-17H2;2*1H/t22-,23-,24-,25-,26+,27+,28+,29+;;/m0../s1 |
| InChIKey | WIUSHSLLYIMGJF-BRUGWHEISA-N |
| XLogP | -1.10 |
| TPSA | 186.78 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.58 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|