C20H31N3O4 — CID 129453387
1-[4-[(3S,4S)-4-hydroxy-1-[[4-(3-hydroxypropoxy)phenyl]methyl]pyrrolidin-3-yl]piperazin-1-yl]ethanone (PubChem CID 129453387) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[4-[(3S,4S)-4-hydroxy-1-[[4-(3-hydroxypropoxy)phenyl]methyl]pyrrolidin-3-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[(3S,4S)-4-hydroxy-1-[[4-(3-hydroxypropoxy)phenyl]methyl]pyrrolidin-3-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 129453387 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 1-[4-[(3S,4S)-4-hydroxy-1-[[4-(3-hydroxypropoxy)phenyl]methyl]pyrrolidin-3-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN([C@H]2CN(Cc3ccc(OCCCO)cc3)C[C@@H]2O)CC1 |
| InChI | InChI=1S/C20H31N3O4/c1-16(25)22-7-9-23(10-8-22)19-14-21(15-20(19)26)13-17-3-5-18(6-4-17)27-12-2-11-24/h3-6,19-20,24,26H,2,7-15H2,1H3/t19-,20-/m0/s1 |
| InChIKey | ALMWITMFQDLKMT-PMACEKPBSA-N |
| XLogP | 0.16 |
| TPSA | 76.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|