C17H24N3O3- — CID 163832011
2-[4-[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]piperazin-1-yl]acetate (PubChem CID 163832011) has the molecular formula C17H24N3O3- and a molecular weight of 318.40 g/mol. Its IUPAC name is 2-[4-[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]piperazin-1-yl]acetate.
| Compound Name | 2-[4-[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 163832011 |
| Molecular Formula | C17H24N3O3- |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-[4-[(3R,4R)-1-benzyl-4-hydroxypyrrolidin-3-yl]piperazin-1-yl]acetate |
| SMILES | O=C([O-])CN1CCN([C@@H]2CN(Cc3ccccc3)C[C@H]2O)CC1 |
| InChI | InChI=1S/C17H25N3O3/c21-16-12-19(10-14-4-2-1-3-5-14)11-15(16)20-8-6-18(7-9-20)13-17(22)23/h1-5,15-16,21H,6-13H2,(H,22,23)/p-1/t15-,16-/m1/s1 |
| InChIKey | OEKHEFXCMVQBTP-HZPDHXFCSA-M |
| XLogP | -1.40 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |