C20H33N3O3S — CID 68862832
(3R,4R)-1-benzyl-4-(4-pentylsulfonylpiperazin-1-yl)pyrrolidin-3-ol (PubChem CID 68862832) has the molecular formula C20H33N3O3S and a molecular weight of 395.57 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-4-(4-pentylsulfonylpiperazin-1-yl)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-1-benzyl-4-(4-pentylsulfonylpiperazin-1-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 68862832 |
| Molecular Formula | C20H33N3O3S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | (3R,4R)-1-benzyl-4-(4-pentylsulfonylpiperazin-1-yl)pyrrolidin-3-ol |
| SMILES | CCCCCS(=O)(=O)N1CCN([C@@H]2CN(Cc3ccccc3)C[C@H]2O)CC1 |
| InChI | InChI=1S/C20H33N3O3S/c1-2-3-7-14-27(25,26)23-12-10-22(11-13-23)19-16-21(17-20(19)24)15-18-8-5-4-6-9-18/h4-6,8-9,19-20,24H,2-3,7,10-17H2,1H3/t19-,20-/m1/s1 |
| InChIKey | BSAQBKGZTULXOY-WOJBJXKFSA-N |
| XLogP | 1.37 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|