C23H33F2N3O3 — CID 129454251
1-[3-[4-[[(3S,4S)-3-(4,4-difluoropiperidin-1-yl)-4-hydroxypyrrolidin-1-yl]methyl]phenoxy]propyl]pyrrolidin-2-one (PubChem CID 129454251) has the molecular formula C23H33F2N3O3 and a molecular weight of 437.53 g/mol. Its IUPAC name is 1-[3-[4-[[(3S,4S)-3-(4,4-difluoropiperidin-1-yl)-4-hydroxypyrrolidin-1-yl]methyl]phenoxy]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[4-[[(3S,4S)-3-(4,4-difluoropiperidin-1-yl)-4-hydroxypyrrolidin-1-yl]methyl]phenoxy]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 129454251 |
| Molecular Formula | C23H33F2N3O3 |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 1-[3-[4-[[(3S,4S)-3-(4,4-difluoropiperidin-1-yl)-4-hydroxypyrrolidin-1-yl]methyl]phenoxy]propyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCOc1ccc(CN2C[C@H](O)[C@@H](N3CCC(F)(F)CC3)C2)cc1 |
| InChI | InChI=1S/C23H33F2N3O3/c24-23(25)8-12-27(13-9-23)20-16-26(17-21(20)29)15-18-4-6-19(7-5-18)31-14-2-11-28-10-1-3-22(28)30/h4-7,20-21,29H,1-3,8-17H2/t20-,21-/m0/s1 |
| InChIKey | DFIOAEKPNJPKEX-SFTDATJTSA-N |
| XLogP | 2.35 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|