C39H38BrF2NO7 — CID 155721014
[(3S,4R,5R,6R)-4,5-dibenzoyloxy-6-(bromomethyl)-1-[2-(4-butoxy-2,6-difluorophenyl)ethyl]piperidin-3-yl] benzoate (PubChem CID 155721014) has the molecular formula C39H38BrF2NO7 and a molecular weight of 750.63 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-4,5-dibenzoyloxy-6-(bromomethyl)-1-[2-(4-butoxy-2,6-difluorophenyl)ethyl]piperidin-3-yl] benzoate.
| Compound Name | [(3S,4R,5R,6R)-4,5-dibenzoyloxy-6-(bromomethyl)-1-[2-(4-butoxy-2,6-difluorophenyl)ethyl]piperidin-3-yl] benzoate |
|---|---|
| PubChem CID | 155721014 |
| Molecular Formula | C39H38BrF2NO7 |
| Molecular Weight | 750.63 g/mol |
| Exact Mass | 749.18 |
| IUPAC Name | [(3S,4R,5R,6R)-4,5-dibenzoyloxy-6-(bromomethyl)-1-[2-(4-butoxy-2,6-difluorophenyl)ethyl]piperidin-3-yl] benzoate |
| SMILES | CCCCOc1cc(F)c(CCN2C[C@H](OC(=O)c3ccccc3)[C@@H](OC(=O)c3ccccc3)[C@H](OC(=O)c3ccccc3)[C@@H]2CBr)c(F)c1 |
| InChI | InChI=1S/C39H38BrF2NO7/c1-2-3-21-47-29-22-31(41)30(32(42)23-29)19-20-43-25-34(48-37(44)26-13-7-4-8-14-26)36(50-39(46)28-17-11-6-12-18-28)35(33(43)24-40)49-38(45)27-15-9-5-10-16-27/h4-18,22-23,33-36H,2-3,19-21,24-25H2,1H3/t33-,34-,35+,36+/m0/s1 |
| InChIKey | ZYRLUZPMELDTHA-CLLHQPRTSA-N |
| XLogP | 7.44 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.63 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|