C29H34O4 — CID 174181590
(5-benzoyloxy-4-tricyclo[6.2.1.02,7]undecanyl) 4-butylbenzoate (PubChem CID 174181590) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is (5-benzoyloxy-4-tricyclo[6.2.1.02,7]undecanyl) 4-butylbenzoate.
| Compound Name | (5-benzoyloxy-4-tricyclo[6.2.1.02,7]undecanyl) 4-butylbenzoate |
|---|---|
| PubChem CID | 174181590 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (5-benzoyloxy-4-tricyclo[6.2.1.02,7]undecanyl) 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)OC2CC3C4CCC(C4)C3CC2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H34O4/c1-2-3-7-19-10-12-21(13-11-19)29(31)33-27-18-25-23-15-14-22(16-23)24(25)17-26(27)32-28(30)20-8-5-4-6-9-20/h4-6,8-13,22-27H,2-3,7,14-18H2,1H3 |
| InChIKey | DPHNXYJBVFAEPW-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |