About [5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate
[5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate (PubChem CID 170674021) has the molecular formula C31H38O4
and a molecular weight of 474.64 g/mol. Its IUPAC name is [5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate.
Molecular Properties
| Compound Name | [5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate |
| PubChem CID | 170674021 |
| Molecular Formula | C31H38O4 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | [5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate |
| SMILES | CC(C)c1ccc(C(=O)OC2CC3C4CCC(C4)C3CC2OC(=O)c2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C31H38O4/c1-18(2)20-5-9-22(10-6-20)30(32)34-28-16-26-24-13-14-25(15-24)27(26)17-29(28)35-31(33)23-11-7-21(8-12-23)19(3)4/h5-12,18-19,24-29H,13-17H2,1-4H3 |
| InChIKey | PLMOOHJJSDCOIQ-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate?
The IUPAC name of [5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate (CID 170674021) is [5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate.
What is the SMILES notation for [5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate?
The canonical SMILES for [5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate is CC(C)c1ccc(C(=O)OC2CC3C4CCC(C4)C3CC2OC(=O)c2ccc(C(C)C)cc2)cc1.
What is the InChIKey of [5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate?
The InChIKey is PLMOOHJJSDCOIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H38O4/c1-18(2)20-5-9-22(10-6-20)30(32)34-28-16-26-24-13-14-25(15-24)27(26)17-29(28)35-31(33)23-11-7-21(8-12-23)19(3)4/h5-12,18-19,24-29H,13-17H2,1-4H3.
What are the key properties of [5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate?
[5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate has a molecular weight of 474.64 g/mol, XLogP of 7.14, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-propan-2-ylbenzoyl)oxy-4-tricyclo[6.2.1.02,7]undecanyl] 4-propan-2-ylbenzoate is sourced from PubChem (CID 170674021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).