C31H40O4 — CID 10695946
ethyl 4-[2-[(3R,5R,8R,9R,10S,13S,14S,17S)-17-acetyl-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethynyl]benzoate (PubChem CID 10695946) has the molecular formula C31H40O4 and a molecular weight of 476.66 g/mol. Its IUPAC name is ethyl 4-[2-[(3R,5R,8R,9R,10S,13S,14S,17S)-17-acetyl-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethynyl]benzoate.
| Compound Name | ethyl 4-[2-[(3R,5R,8R,9R,10S,13S,14S,17S)-17-acetyl-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethynyl]benzoate |
|---|---|
| PubChem CID | 10695946 |
| Molecular Formula | C31H40O4 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | ethyl 4-[2-[(3R,5R,8R,9R,10S,13S,14S,17S)-17-acetyl-3-hydroxy-13-methyl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethynyl]benzoate |
| SMILES | CCOC(=O)c1ccc(C#C[C@@]2(O)CC[C@H]3[C@H](CC[C@@H]4[C@@H]3CC[C@]3(C)[C@@H](C(C)=O)CC[C@@H]43)C2)cc1 |
| InChI | InChI=1S/C31H40O4/c1-4-35-29(33)22-7-5-21(6-8-22)13-17-31(34)18-15-24-23(19-31)9-10-26-25(24)14-16-30(3)27(20(2)32)11-12-28(26)30/h5-8,23-28,34H,4,9-12,14-16,18-19H2,1-3H3/t23-,24+,25-,26-,27-,28+,30-,31-/m1/s1 |
| InChIKey | KABZGKRVBMZEGT-JIEKYQNDSA-N |
| XLogP | 5.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|