C34H42O4 — CID 170674035
[5-(4-butylbenzoyl)oxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 4-butylbenzoate (PubChem CID 170674035) has the molecular formula C34H42O4 and a molecular weight of 514.71 g/mol. Its IUPAC name is [5-(4-butylbenzoyl)oxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 4-butylbenzoate.
| Compound Name | [5-(4-butylbenzoyl)oxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 4-butylbenzoate |
|---|---|
| PubChem CID | 170674035 |
| Molecular Formula | C34H42O4 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | [5-(4-butylbenzoyl)oxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 4-butylbenzoate |
| SMILES | CCCCc1ccc(C(=O)OC2C3CC(C2OC(=O)c2ccc(CCCC)cc2)C2C4CCC(C4)C32)cc1 |
| InChI | InChI=1S/C34H42O4/c1-3-5-7-21-9-13-23(14-10-21)33(35)37-31-27-20-28(30-26-18-17-25(19-26)29(27)30)32(31)38-34(36)24-15-11-22(12-16-24)8-6-4-2/h9-16,25-32H,3-8,17-20H2,1-2H3 |
| InChIKey | OLBGWYZRSQZTCO-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|