C20H31N3O5 — CID 154941459
4-[2-[2-ethyl-4-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]phenoxy]ethyl]piperazine-1-carboxylic acid (PubChem CID 154941459) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is 4-[2-[2-ethyl-4-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]phenoxy]ethyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[2-[2-ethyl-4-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]phenoxy]ethyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 154941459 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 4-[2-[2-ethyl-4-[(1-methoxy-2-methyl-1-oxopropan-2-yl)amino]phenoxy]ethyl]piperazine-1-carboxylic acid |
| SMILES | CCc1cc(NC(C)(C)C(=O)OC)ccc1OCCN1CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C20H31N3O5/c1-5-15-14-16(21-20(2,3)18(24)27-4)6-7-17(15)28-13-12-22-8-10-23(11-9-22)19(25)26/h6-7,14,21H,5,8-13H2,1-4H3,(H,25,26) |
| InChIKey | ZKILYDQYMYERPQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|