C25H38N4O3 — CID 154945149
tert-butyl 4-[2-[4-[(1-cyanocyclobutyl)amino]-2-ethylphenoxy]ethyl]-2-methylpiperazine-1-carboxylate (PubChem CID 154945149) has the molecular formula C25H38N4O3 and a molecular weight of 442.60 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-[(1-cyanocyclobutyl)amino]-2-ethylphenoxy]ethyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-[(1-cyanocyclobutyl)amino]-2-ethylphenoxy]ethyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 154945149 |
| Molecular Formula | C25H38N4O3 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | tert-butyl 4-[2-[4-[(1-cyanocyclobutyl)amino]-2-ethylphenoxy]ethyl]-2-methylpiperazine-1-carboxylate |
| SMILES | CCc1cc(NC2(C#N)CCC2)ccc1OCCN1CCN(C(=O)OC(C)(C)C)C(C)C1 |
| InChI | InChI=1S/C25H38N4O3/c1-6-20-16-21(27-25(18-26)10-7-11-25)8-9-22(20)31-15-14-28-12-13-29(19(2)17-28)23(30)32-24(3,4)5/h8-9,16,19,27H,6-7,10-15,17H2,1-5H3 |
| InChIKey | CKBMTTFRGKTBSS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|