C21H30N4O3 — CID 154941426
(2S)-4-[2-[4-[(1-cyanocyclobutyl)amino]-2-ethylphenoxy]ethyl]-2-methylpiperazine-1-carboxylic acid (PubChem CID 154941426) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is (2S)-4-[2-[4-[(1-cyanocyclobutyl)amino]-2-ethylphenoxy]ethyl]-2-methylpiperazine-1-carboxylic acid.
| Compound Name | (2S)-4-[2-[4-[(1-cyanocyclobutyl)amino]-2-ethylphenoxy]ethyl]-2-methylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 154941426 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | (2S)-4-[2-[4-[(1-cyanocyclobutyl)amino]-2-ethylphenoxy]ethyl]-2-methylpiperazine-1-carboxylic acid |
| SMILES | CCc1cc(NC2(C#N)CCC2)ccc1OCCN1CCN(C(=O)O)[C@@H](C)C1 |
| InChI | InChI=1S/C21H30N4O3/c1-3-17-13-18(23-21(15-22)7-4-8-21)5-6-19(17)28-12-11-24-9-10-25(20(26)27)16(2)14-24/h5-6,13,16,23H,3-4,7-12,14H2,1-2H3,(H,26,27)/t16-/m0/s1 |
| InChIKey | QBRIRJMYMYIUGH-INIZCTEOSA-N |
| XLogP | 3.17 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|