C16H19F2N3O5 — CID 154941355
(2S)-4-[2-[2-(2,2-difluoroethenyl)-4-nitrophenoxy]ethyl]-2-methylpiperazine-1-carboxylic acid (PubChem CID 154941355) has the molecular formula C16H19F2N3O5 and a molecular weight of 371.34 g/mol. Its IUPAC name is (2S)-4-[2-[2-(2,2-difluoroethenyl)-4-nitrophenoxy]ethyl]-2-methylpiperazine-1-carboxylic acid.
| Compound Name | (2S)-4-[2-[2-(2,2-difluoroethenyl)-4-nitrophenoxy]ethyl]-2-methylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 154941355 |
| Molecular Formula | C16H19F2N3O5 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | (2S)-4-[2-[2-(2,2-difluoroethenyl)-4-nitrophenoxy]ethyl]-2-methylpiperazine-1-carboxylic acid |
| SMILES | C[C@H]1CN(CCOc2ccc([N+](=O)[O-])cc2C=C(F)F)CCN1C(=O)O |
| InChI | InChI=1S/C16H19F2N3O5/c1-11-10-19(4-5-20(11)16(22)23)6-7-26-14-3-2-13(21(24)25)8-12(14)9-15(17)18/h2-3,8-9,11H,4-7,10H2,1H3,(H,22,23)/t11-/m0/s1 |
| InChIKey | KUSSGWZXIJTNMJ-NSHDSACASA-N |
| XLogP | 2.90 |
| TPSA | 96.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|