C26H41N3O7 — CID 171774330
tert-butyl 2-[(2S,6R)-4-[2-(2-ethenyl-4-nitrophenoxy)ethyl]-2,6-dimethylpiperazin-1-yl]acetate;1,4-dioxane (PubChem CID 171774330) has the molecular formula C26H41N3O7 and a molecular weight of 507.63 g/mol. Its IUPAC name is tert-butyl 2-[(2S,6R)-4-[2-(2-ethenyl-4-nitrophenoxy)ethyl]-2,6-dimethylpiperazin-1-yl]acetate;1,4-dioxane.
| Compound Name | tert-butyl 2-[(2S,6R)-4-[2-(2-ethenyl-4-nitrophenoxy)ethyl]-2,6-dimethylpiperazin-1-yl]acetate;1,4-dioxane |
|---|---|
| PubChem CID | 171774330 |
| Molecular Formula | C26H41N3O7 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | tert-butyl 2-[(2S,6R)-4-[2-(2-ethenyl-4-nitrophenoxy)ethyl]-2,6-dimethylpiperazin-1-yl]acetate;1,4-dioxane |
| SMILES | C1COCCO1.C=Cc1cc([N+](=O)[O-])ccc1OCCN1C[C@@H](C)N(CC(=O)OC(C)(C)C)[C@@H](C)C1 |
| InChI | InChI=1S/C22H33N3O5.C4H8O2/c1-7-18-12-19(25(27)28)8-9-20(18)29-11-10-23-13-16(2)24(17(3)14-23)15-21(26)30-22(4,5)6;1-2-6-4-3-5-1/h7-9,12,16-17H,1,10-11,13-15H2,2-6H3;1-4H2/t16-,17+; |
| InChIKey | SEOPOCCCUHSUFD-OKZTUQRJSA-N |
| XLogP | 3.39 |
| TPSA | 103.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|