C19H29N3O7 — CID 178006537
2-[4-[2-(4-amino-2-ethylphenoxy)ethyl]-2-methylpiperazin-1-yl]acetic acid;oxalic acid (PubChem CID 178006537) has the molecular formula C19H29N3O7 and a molecular weight of 411.46 g/mol. Its IUPAC name is 2-[4-[2-(4-amino-2-ethylphenoxy)ethyl]-2-methylpiperazin-1-yl]acetic acid;oxalic acid.
| Compound Name | 2-[4-[2-(4-amino-2-ethylphenoxy)ethyl]-2-methylpiperazin-1-yl]acetic acid;oxalic acid |
|---|---|
| PubChem CID | 178006537 |
| Molecular Formula | C19H29N3O7 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-[4-[2-(4-amino-2-ethylphenoxy)ethyl]-2-methylpiperazin-1-yl]acetic acid;oxalic acid |
| SMILES | CCc1cc(N)ccc1OCCN1CCN(CC(=O)O)C(C)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H27N3O3.C2H2O4/c1-3-14-10-15(18)4-5-16(14)23-9-8-19-6-7-20(12-17(21)22)13(2)11-19;3-1(4)2(5)6/h4-5,10,13H,3,6-9,11-12,18H2,1-2H3,(H,21,22);(H,3,4)(H,5,6) |
| InChIKey | XNSFJXQRYNJLAV-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 153.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|