C20H33N3O3 — CID 154945186
2-[(2R,6S)-4-[2-(4-amino-5-methyl-2-propan-2-ylphenoxy)ethyl]-2,6-dimethylpiperazin-1-yl]acetic acid (PubChem CID 154945186) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is 2-[(2R,6S)-4-[2-(4-amino-5-methyl-2-propan-2-ylphenoxy)ethyl]-2,6-dimethylpiperazin-1-yl]acetic acid.
| Compound Name | 2-[(2R,6S)-4-[2-(4-amino-5-methyl-2-propan-2-ylphenoxy)ethyl]-2,6-dimethylpiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 154945186 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | 2-[(2R,6S)-4-[2-(4-amino-5-methyl-2-propan-2-ylphenoxy)ethyl]-2,6-dimethylpiperazin-1-yl]acetic acid |
| SMILES | Cc1cc(OCCN2C[C@@H](C)N(CC(=O)O)[C@@H](C)C2)c(C(C)C)cc1N |
| InChI | InChI=1S/C20H33N3O3/c1-13(2)17-9-18(21)14(3)8-19(17)26-7-6-22-10-15(4)23(12-20(24)25)16(5)11-22/h8-9,13,15-16H,6-7,10-12,21H2,1-5H3,(H,24,25)/t15-,16+ |
| InChIKey | HWJBELXBXZWHRE-IYBDPMFKSA-N |
| XLogP | 2.56 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|