C20H31F2N3O3 — CID 154941367
butyl (2S)-4-[2-[4-amino-2-(2,2-difluoroethyl)phenoxy]ethyl]-2-methylpiperazine-1-carboxylate (PubChem CID 154941367) has the molecular formula C20H31F2N3O3 and a molecular weight of 399.48 g/mol. Its IUPAC name is butyl (2S)-4-[2-[4-amino-2-(2,2-difluoroethyl)phenoxy]ethyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | butyl (2S)-4-[2-[4-amino-2-(2,2-difluoroethyl)phenoxy]ethyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 154941367 |
| Molecular Formula | C20H31F2N3O3 |
| Molecular Weight | 399.48 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | butyl (2S)-4-[2-[4-amino-2-(2,2-difluoroethyl)phenoxy]ethyl]-2-methylpiperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(CCOc2ccc(N)cc2CC(F)F)C[C@@H]1C |
| InChI | InChI=1S/C20H31F2N3O3/c1-3-4-10-28-20(26)25-8-7-24(14-15(25)2)9-11-27-18-6-5-17(23)12-16(18)13-19(21)22/h5-6,12,15,19H,3-4,7-11,13-14,23H2,1-2H3/t15-/m0/s1 |
| InChIKey | KQCKXIXEHCPLDJ-HNNXBMFYSA-N |
| XLogP | 3.40 |
| TPSA | 68.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.48 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|