C25H40N4O3 — CID 154945175
tert-butyl 4-[2-[4-(2-cyanopropan-2-ylamino)-2-propan-2-ylphenoxy]ethyl]-2-methylpiperazine-1-carboxylate (PubChem CID 154945175) has the molecular formula C25H40N4O3 and a molecular weight of 444.62 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-(2-cyanopropan-2-ylamino)-2-propan-2-ylphenoxy]ethyl]-2-methylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-(2-cyanopropan-2-ylamino)-2-propan-2-ylphenoxy]ethyl]-2-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 154945175 |
| Molecular Formula | C25H40N4O3 |
| Molecular Weight | 444.62 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | tert-butyl 4-[2-[4-(2-cyanopropan-2-ylamino)-2-propan-2-ylphenoxy]ethyl]-2-methylpiperazine-1-carboxylate |
| SMILES | CC(C)c1cc(NC(C)(C)C#N)ccc1OCCN1CCN(C(=O)OC(C)(C)C)C(C)C1 |
| InChI | InChI=1S/C25H40N4O3/c1-18(2)21-15-20(27-25(7,8)17-26)9-10-22(21)31-14-13-28-11-12-29(19(3)16-28)23(30)32-24(4,5)6/h9-10,15,18-19,27H,11-14,16H2,1-8H3 |
| InChIKey | AHWLTBFMRBMBRE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|