C34H40N2O5 — CID 146566746
4-[2-[4-[(E)-1-[4-(2,2-dimethylpropanoyloxy)phenyl]-2-phenylbut-1-enyl]phenoxy]ethyl]piperazine-1-carboxylic acid (PubChem CID 146566746) has the molecular formula C34H40N2O5 and a molecular weight of 556.70 g/mol. Its IUPAC name is 4-[2-[4-[(E)-1-[4-(2,2-dimethylpropanoyloxy)phenyl]-2-phenylbut-1-enyl]phenoxy]ethyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[2-[4-[(E)-1-[4-(2,2-dimethylpropanoyloxy)phenyl]-2-phenylbut-1-enyl]phenoxy]ethyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 146566746 |
| Molecular Formula | C34H40N2O5 |
| Molecular Weight | 556.70 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | 4-[2-[4-[(E)-1-[4-(2,2-dimethylpropanoyloxy)phenyl]-2-phenylbut-1-enyl]phenoxy]ethyl]piperazine-1-carboxylic acid |
| SMILES | CC/C(=C(/c1ccc(OCCN2CCN(C(=O)O)CC2)cc1)c1ccc(OC(=O)C(C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C34H40N2O5/c1-5-30(25-9-7-6-8-10-25)31(27-13-17-29(18-14-27)41-32(37)34(2,3)4)26-11-15-28(16-12-26)40-24-23-35-19-21-36(22-20-35)33(38)39/h6-18H,5,19-24H2,1-4H3,(H,38,39)/b31-30+ |
| InChIKey | VTUBTGFLEXCNTG-NVQSTNCTSA-N |
| XLogP | 6.68 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.70 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|