C29H32INO — CID 67686022
1-[3-[4-[(Z)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]propyl]pyrrolidine (PubChem CID 67686022) has the molecular formula C29H32INO and a molecular weight of 537.49 g/mol. Its IUPAC name is 1-[3-[4-[(Z)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]propyl]pyrrolidine.
| Compound Name | 1-[3-[4-[(Z)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]propyl]pyrrolidine |
|---|---|
| PubChem CID | 67686022 |
| Molecular Formula | C29H32INO |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.15 |
| IUPAC Name | 1-[3-[4-[(Z)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]propyl]pyrrolidine |
| SMILES | CC/C(=C(/c1ccc(I)cc1)c1ccc(OCCCN2CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H32INO/c1-2-28(23-9-4-3-5-10-23)29(24-11-15-26(30)16-12-24)25-13-17-27(18-14-25)32-22-8-21-31-19-6-7-20-31/h3-5,9-18H,2,6-8,19-22H2,1H3/b29-28+ |
| InChIKey | FXONXUZYNJRDKV-ZQHSETAFSA-N |
| XLogP | 7.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|