C28H30INO2 — CID 87912681
1-[2-[4-[(Z)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-1-oxidopyrrolidin-1-ium (PubChem CID 87912681) has the molecular formula C28H30INO2 and a molecular weight of 539.46 g/mol. Its IUPAC name is 1-[2-[4-[(Z)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-1-oxidopyrrolidin-1-ium.
| Compound Name | 1-[2-[4-[(Z)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-1-oxidopyrrolidin-1-ium |
|---|---|
| PubChem CID | 87912681 |
| Molecular Formula | C28H30INO2 |
| Molecular Weight | 539.46 g/mol |
| Exact Mass | 539.13 |
| IUPAC Name | 1-[2-[4-[(Z)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]ethyl]-1-oxidopyrrolidin-1-ium |
| SMILES | CC/C(=C(/c1ccc(I)cc1)c1ccc(OCC[N+]2([O-])CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H30INO2/c1-2-27(22-8-4-3-5-9-22)28(23-10-14-25(29)15-11-23)24-12-16-26(17-13-24)32-21-20-30(31)18-6-7-19-30/h3-5,8-17H,2,6-7,18-21H2,1H3/b28-27+ |
| InChIKey | SVUHPAMLHKKUSP-BYYHNAKLSA-N |
| XLogP | 7.15 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.46 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|