C30H35IN2O — CID 174499789
2-[4-[(E)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]-N-methyl-N-(pyrrolidin-2-ylmethyl)ethanamine (PubChem CID 174499789) has the molecular formula C30H35IN2O and a molecular weight of 566.53 g/mol. Its IUPAC name is 2-[4-[(E)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]-N-methyl-N-(pyrrolidin-2-ylmethyl)ethanamine.
| Compound Name | 2-[4-[(E)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]-N-methyl-N-(pyrrolidin-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 174499789 |
| Molecular Formula | C30H35IN2O |
| Molecular Weight | 566.53 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 2-[4-[(E)-1-(4-iodophenyl)-2-phenylbut-1-enyl]phenoxy]-N-methyl-N-(pyrrolidin-2-ylmethyl)ethanamine |
| SMILES | CC/C(=C(\c1ccc(I)cc1)c1ccc(OCCN(C)CC2CCCN2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H35IN2O/c1-3-29(23-8-5-4-6-9-23)30(24-11-15-26(31)16-12-24)25-13-17-28(18-14-25)34-21-20-33(2)22-27-10-7-19-32-27/h4-6,8-9,11-18,27,32H,3,7,10,19-22H2,1-2H3/b30-29- |
| InChIKey | UXRDYELFNKSCRP-FLWNBWAVSA-N |
| XLogP | 6.72 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.53 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|